Name | L-Ascorbic acid 6-stearate |
Synonyms | Vitamin C stearate Ascorbyl 6-stearate 6-O-Stearylascorbic acid L-Ascorbic acid 6-stearate L-Ascorbic acid 6-octadecanoate 6-O-octadecanoylhex-1-enofuranos-3-ulose 2-(3,4-dihydroxy-5-oxo-2,5-dihydrofuran-2-yl)-2-hydroxyethyl octadecanoate (non-preferred name) |
CAS | 10605-09-1 |
EINECS | 234-231-5 |
InChI | InChI=1/C24H42O7/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-20(26)30-18-19(25)23-21(27)22(28)24(29)31-23/h19,23,25,27-28H,2-18H2,1H3 |
Molecular Formula | C24H42O7 |
Molar Mass | 442.586 |
Density | 1.125g/cm3 |
Melting Point | 117 °C |
Boling Point | 536°C at 760 mmHg |
Flash Point | 168.5°C |
Vapor Presure | 1.01E-13mmHg at 25°C |
Storage Condition | Room Temprature |
Refractive Index | 1.516 |
Physical and Chemical Properties | Density 1.125 |
Use | Vitamins |
acidity coefficient (pKa) | 3.96±0.10(Predicted) |
category | toxic substances |
toxicity classification | low toxicity |
acute toxicity | oral-mouse LD50: 25070 mg/kg |
flammability hazard characteristics | Flammable, spicy and irritating smoke from the fire scene |
storage and transportation characteristics | warehouse low temperature, ventilation, drying |
fire extinguishing agent | water, carbon dioxide, dry powder, sand |
RTECS number | CI7671310 |
customs code | 2936270000 |